1. Home
  2. Undecanoic acid, 2-heptyl-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

Undecanoic acid, 2-heptyl-

CCCCCCCCCC(C(=O)O)CCCCCCC Request for Quotation
Chemical Name: Undecanoic acid, 2-heptyl-
CAS Number: 22890-21-7
Product Number: AG002LCY(AGN-PC-001KW4)
Synonyms:
MDL No:
Molecular Formula: C18H36O2
Molecular Weight: 284.4772

Identification/Properties

Safety Information

GHS Pictogram:
N/A
Signal Word:
UN#:
-
Hazard Statements:
-
Precautionary Statements:
Class:
-
Packing Group:
-

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


2-Heptylundecanoic acid is a versatile compound widely used in chemical synthesis due to its unique chemical properties. This carboxylic acid with a molecular formula of C19H38O2 is known for its ability to act as a building block in organic synthesis. Its long carbon chain and carboxylic acid functional group make it a valuable intermediate in the preparation of various derivatives and compounds.In chemical synthesis, 2-Heptylundecanoic acid can be used as a precursor for the synthesis of esters, amides, and other derivatives. By reacting with different reagents or functional groups, it can undergo various transformation reactions to yield diverse products. For example, its carboxylic acid group can be activated for esterification reactions, leading to the formation of esters with different alkyl or aryl groups. It can also participate in amidation reactions to form amides by reacting with amines.Additionally, 2-Heptylundecanoic acid can be utilized in the synthesis of surfactants, lubricants, and other specialty chemicals. Its long hydrophobic carbon chain makes it a suitable candidate for the modification of surface-active agents, where it can improve the solubility and stability of the final products. Furthermore, its structure can be modified through functional group manipulations to tailor its properties for specific applications in the chemical industry.Overall, 2-Heptylundecanoic acid plays a crucial role in chemical synthesis by serving as a key building block for the preparation of various compounds and materials. Its versatility and reactivity make it a valuable asset in synthetic chemistry, offering a wide range of possibilities for the creation of new molecules and products.