1. Home
  2. 3-Butene-1-sulfonamide

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

3-Butene-1-sulfonamide

C=CCCS(=O)(=O)N Request for Quotation
Chemical Name: 3-Butene-1-sulfonamide
CAS Number: 291514-02-8
Product Number: AG01AHKY(AGN-PC-0091QS)
Synonyms:
MDL No:
Molecular Formula: C4H9NO2S
Molecular Weight: 135.18476

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


But-3-ene-1-sulfonamide, also known as $name$, is a versatile compound widely used in various chemical synthesis processes. Its primary application lies in its ability to serve as a crucial building block in the creation of complex organic molecules. With its reactive sulfonamide group and unsaturated carbon-carbon double bond, $name$ offers chemists a unique platform for the synthesis of diverse chemical structures.In organic chemistry, $name$ is commonly employed as a nucleophile in various reactions such as nucleophilic addition and substitution reactions. Its sulfonamide group enables the compound to participate in nucleophilic attacks, allowing for the formation of new carbon-carbon or carbon-heteroatom bonds. This characteristic makes $name$ an invaluable tool in the synthesis of pharmaceuticals, agrochemicals, and other biologically active molecules.Moreover, the presence of the carbon-carbon double bond in the structure of $name$ provides additional reactivity and flexibility in chemical transformations. Chemists can leverage this unsaturation to introduce functional groups or construct complex molecular frameworks through a series of selective chemical reactions. The versatility of $name$ in chemical synthesis makes it a crucial component in the toolbox of organic chemists seeking to design and create novel compounds with diverse applications.In summary, But-3-ene-1-sulfonamide plays a pivotal role in chemical synthesis by serving as a versatile building block for the construction of complex organic molecules. Its unique structural features enable chemists to access a wide range of chemical transformations, making it an indispensable resource in the pursuit of novel and innovative synthetic strategies.