1. Home
  2. 2(3H)-Furanone, 3-bromodihydro-3-methyl-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

2(3H)-Furanone, 3-bromodihydro-3-methyl-

O=C1OCCC1(C)Br Request for Quotation
Chemical Name: 2(3H)-Furanone, 3-bromodihydro-3-methyl-
CAS Number: 33693-67-3
Product Number: AG003VFP(AGN-PC-00Q42R)
Synonyms:
MDL No:
Molecular Formula: C5H7BrO2
Molecular Weight: 179.01188

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


3-Bromo-3-methyl-2-butyrolactone, also known as $name$, is a versatile compound used in various chemical synthesis processes. This compound is particularly valued for its ability to serve as a key intermediate in the preparation of organic molecules with diverse functionalities.One important application of 3-Bromo-3-methyl-2-butyrolactone is in the synthesis of pharmaceutical compounds. By serving as a building block, this compound can be used to construct complex molecular structures that are essential for the development of new drugs and therapeutic agents. Its unique chemical reactivity allows for the modification of functional groups, enabling the creation of specific drug candidates with desired properties.Furthermore, 3-Bromo-3-methyl-2-butyrolactone plays a crucial role in the field of materials science. Its incorporation into polymer chains and organic frameworks can lead to the formation of novel materials with tailored properties, such as enhanced mechanical strength or improved performance characteristics. This compound's versatility opens up possibilities for designing advanced materials for various applications, including coatings, adhesives, and electronic devices.Additionally, in the realm of agrochemicals, 3-Bromo-3-methyl-2-butyrolactone is utilized in the synthesis of pesticides and herbicides. Its reactivity allows for the synthesis of active ingredients that target specific pests or weeds while minimizing environmental impact. This compound's role in agricultural chemistry illustrates its significance in addressing the global challenges of food security and crop protection.Overall, the diverse applications of 3-Bromo-3-methyl-2-butyrolactone in chemical synthesis highlight its importance as a valuable building block for the creation of various compounds with significant industrial and scientific implications.