1. Home
  2. 2-[5-chloro-1'-[(2-fluorophenyl)methyl]-2,2',5'-trioxospiro[indole-3,3'-pyrrolidine]-1-yl]acetic acid

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

2-[5-chloro-1'-[(2-fluorophenyl)methyl]-2,2',5'-trioxospiro[indole-3,3'-pyrrolidine]-1-yl]acetic acid

OC(=O)CN1c2ccc(cc2C2(C1=O)CC(=O)N(C2=O)Cc1ccccc1F)Cl Request for Quotation
Chemical Name: 2-[5-chloro-1'-[(2-fluorophenyl)methyl]-2,2',5'-trioxospiro[indole-3,3'-pyrrolidine]-1-yl]acetic acid
CAS Number: 916046-55-4
Product Number: AG00GTAN(AGN-PC-00QBQ1)
Synonyms:
MDL No:
Molecular Formula: C20H14ClFN2O5
Molecular Weight: 416.7869632

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


5-Chloro-1'-[(2-fluorophenyl)methyl]-2,2',5'-trioxo-spiro[3H-indole-3,3'-pyrrolidine-1(2H)-acetic acid, commonly known as $name$, is a versatile compound widely used in chemical synthesis. This unique molecule plays a crucial role in various synthetic processes, particularly in the pharmaceutical industry.In chemical synthesis, $name$ can be utilized as a key building block for the construction of complex organic molecules. Its strategic placement of functional groups allows for precise modifications and derivatizations, enabling chemists to synthesize a diverse range of target compounds efficiently.$name$ is known for its ability to act as a scaffold for the synthesis of bioactive molecules, including potential drug candidates. By incorporating this spirocyclic structure into the molecular design, researchers can explore new chemical space and enhance the pharmacological properties of the resulting compounds.Furthermore, the presence of both a chloro and a fluoro substituent on the aromatic rings of $name$ offers opportunities for further diversification through cross-coupling reactions and functional group manipulations. This enables access to structurally diverse compounds with tailored properties for specific applications in drug discovery and material science.