1. Home
  2. 2-Oxazolepropanoicacid, 5-(4-bromophenyl)-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

2-Oxazolepropanoicacid, 5-(4-bromophenyl)-

OC(=O)CCc1ncc(o1)c1ccc(cc1)Br Request for Quotation
Chemical Name: 2-Oxazolepropanoicacid, 5-(4-bromophenyl)-
CAS Number: 23464-96-2
Product Number: AG002NBR(AGN-PC-00S1ZX)
Synonyms:
MDL No:
Molecular Formula: C12H10BrNO3
Molecular Weight: 296.1167

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


The 5-(4-Bromophenyl)oxazole-2-propionic acid is a versatile compound widely utilized in chemical synthesis for its unique properties and reactivity. This compound serves as a valuable building block in the preparation of various organic molecules and pharmaceutical intermediates due to its functional groups and structural characteristics.One of the key applications of 5-(4-Bromophenyl)oxazole-2-propionic acid is its use as a precursor in the synthesis of heterocyclic compounds. By reacting with other reagents or molecules under specific conditions, this acid can undergo different chemical transformations to yield diverse products with desired structures and functionalities. These derivatives can exhibit a range of biological activities, making them valuable for drug discovery and development.Furthermore, the presence of the oxazole ring in the structure of 5-(4-Bromophenyl)oxazole-2-propionic acid imparts unique properties to the compound, such as electron density and aromaticity, which can influence its reactivity and interactions with other molecules. This makes it a valuable component in designing and synthesizing new compounds with targeted properties for various applications in medicinal chemistry, materials science, and other fields of research.In summary, the 5-(4-Bromophenyl)oxazole-2-propionic acid plays a crucial role in chemical synthesis by serving as a versatile building block for the creation of diverse organic molecules and pharmaceutical intermediates. Its unique structure and reactivity offer opportunities for the development of novel compounds with potential applications across different industries.