1. Home
  2. 4(1H)-Pyrimidinethione, 2,6-diamino-, sulfate (1:1)

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

4(1H)-Pyrimidinethione, 2,6-diamino-, sulfate (1:1)

OS(=O)(=O)O.Nc1nc(N)[nH]c(=S)c1 Request for Quotation
Chemical Name: 4(1H)-Pyrimidinethione, 2,6-diamino-, sulfate (1:1)
CAS Number: 307496-37-3
Product Number: AG00314V(AGN-PC-00UO0U)
Synonyms:
MDL No:
Molecular Formula: C4H8N4O4S2
Molecular Weight: 240.2607

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


2,6-Diaminopyrimidine-4-thiol sulfate, commonly referred to as DAPTS, is a versatile compound that plays a crucial role in chemical synthesis. With its unique structure and reactivity, DAPTS is widely used as a key intermediate in the production of various pharmaceuticals, agrochemicals, and specialty chemicals.In chemical synthesis, DAPTS serves as a valuable building block for the construction of complex molecules due to its ability to participate in various reactions. It can undergo nucleophilic substitution reactions, allowing for the introduction of functional groups at specific positions on the molecule. Additionally, DAPTS can act as a ligand in coordination chemistry, facilitating the formation of metal complexes with unique properties.Furthermore, DAPTS is known for its exceptional stability and compatibility with a wide range of reaction conditions, making it a preferred choice for chemists working on the synthesis of intricate organic compounds. Its versatility and reliability make it an indispensable tool in the development of novel materials and bioactive substances.Overall, the application of 2,6-Diaminopyrimidine-4-thiol sulfate in chemical synthesis presents exciting possibilities for researchers and industry professionals seeking to explore new avenues in drug discovery, materials science, and beyond.