1. Home
  2. Pyrazine, (1-bromoethyl)-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

Pyrazine, (1-bromoethyl)-

CC(c1cnccn1)Br Request for Quotation
Chemical Name: Pyrazine, (1-bromoethyl)-
CAS Number: 91920-65-9
Product Number: AG0067UG(AGN-PC-02OIZO)
Synonyms:
MDL No:
Molecular Formula: C6H7BrN2
Molecular Weight: 187.0372

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


2-(1-Bromoethyl)pyrazine is a versatile chemical compound that finds application in various chemical synthesis processes. As a primary bromoalkylpyrazine, it serves as a valuable building block in the synthesis of complex organic molecules.One of the key applications of 2-(1-Bromoethyl)pyrazine is in the preparation of pharmaceutical intermediates. Its ability to undergo various chemical reactions, such as nucleophilic substitution and cross-coupling reactions, makes it an important precursor in the pharmaceutical industry. By introducing specific functional groups onto the pyrazine ring, researchers can create novel drug candidates with enhanced biological activities.Additionally, 2-(1-Bromoethyl)pyrazine is utilized in the synthesis of agrochemicals and specialty chemicals. Its unique structure enables chemists to modify its chemical properties and construct molecules with tailored characteristics. This compound plays a crucial role in the development of new materials, catalysts, and advanced organic compounds.Overall, 2-(1-Bromoethyl)pyrazine is a valuable reagent in chemical synthesis, offering diverse pathways for the creation of complex molecules with pharmaceutical, agricultural, and industrial applications.