1. Home
  2. (1-methylimidazol-4-yl)methanol;hydrochloride

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

(1-methylimidazol-4-yl)methanol;hydrochloride

Cn1cc(nc1)CO.Cl Request for Quotation
Chemical Name: (1-methylimidazol-4-yl)methanol;hydrochloride
CAS Number: 96831-65-1
Product Number: AG00IJV5(AGN-PC-02U6GZ)
Synonyms:
MDL No:
Molecular Formula: C5H9ClN2O
Molecular Weight: 148.5908

Identification/Properties

Safety Information

GHS Pictogram:
N/A
Signal Word:
UN#:
-
Hazard Statements:
-
Precautionary Statements:
Class:
-
Packing Group:
-

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


The (1-Methyl-1H-imidazol-4-yl)methanol hydrochloride compound is a versatile chemical reagent that plays a crucial role in the realm of chemical synthesis. With its unique molecular structure, this compound serves as a valuable building block in the creation of various organic molecules and pharmaceutical intermediates. In chemical synthesis, (1-Methyl-1H-imidazol-4-yl)methanol hydrochloride is frequently employed as a catalyst, facilitating key reactions in the formation of complex compounds. Its presence can enable the modification of functional groups, the formation of carbon-carbon bonds, and the synthesis of heterocyclic structures. This compound's reactivity and compatibility with a wide range of reaction conditions make it a valuable tool for chemists seeking to design and produce novel molecules with specific properties.Furthermore, the (1-Methyl-1H-imidazol-4-yl)methanol hydrochloride compound is known for its high purity and stability, ensuring consistency and reliability in chemical synthesis processes. Its precise control over reaction pathways and selectivity make it a preferred choice for organic chemists working on intricate synthesis schemes. By incorporating this compound into their synthetic routes, researchers can achieve greater efficiency and precision in the preparation of target molecules for various applications.Overall, the application of (1-Methyl-1H-imidazol-4-yl)methanol hydrochloride in chemical synthesis underscores its importance as a valuable reagent for advancing the field of organic chemistry and drug discovery.