1. Home
  2. 2-Pyridinemethanol, 6-(aminomethyl)-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

2-Pyridinemethanol, 6-(aminomethyl)-

NCc1cccc(n1)CO Request for Quotation
Chemical Name: 2-Pyridinemethanol, 6-(aminomethyl)-
CAS Number: 50501-31-0
Product Number: AG006YJS(AGN-PC-035H1Q)
Synonyms:
MDL No:
Molecular Formula: C7H10N2O
Molecular Weight: 138.1671

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


(6-(Aminomethyl)pyridin-2-yl)methanol, also known as $name$, is a versatile compound widely utilized in chemical synthesis for various applications. In the realm of organic chemistry, this compound serves as a valuable building block in the synthesis of diverse molecules due to its unique chemical properties. One key application of (6-(Aminomethyl)pyridin-2-yl)methanol is in the development of pharmaceuticals. Its structural characteristics make it an essential intermediate in the creation of bioactive molecules and drug candidates. By incorporating this compound into the synthesis of pharmaceutical agents, researchers can tailor specific properties and enhance the efficacy of the final product.Furthermore, (6-(Aminomethyl)pyridin-2-yl)methanol plays a crucial role in the preparation of functional materials, such as polymers, agrochemicals, and dyes. Its reactivity and ability to participate in various chemical reactions make it a valuable tool in designing innovative materials with desirable properties.In summary, the application of (6-(Aminomethyl)pyridin-2-yl)methanol in chemical synthesis extends across multiple sectors, from drug development to material science, highlighting its significance as a versatile compound in the field of organic chemistry.