1. Home
  2. Phenol, 2-amino-5-(aminomethyl)-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

Phenol, 2-amino-5-(aminomethyl)-

NCc1ccc(c(c1)O)N Request for Quotation
Chemical Name: Phenol, 2-amino-5-(aminomethyl)-
CAS Number: 920511-81-5
Product Number: AG00H315(AGN-PC-039CEG)
Synonyms:
MDL No:
Molecular Formula: C7H10N2O
Molecular Weight: 138.1671

Identification/Properties

Safety Information

GHS Pictogram:
N/A
Signal Word:
UN#:
-
Hazard Statements:
-
Precautionary Statements:
Class:
-
Packing Group:
-

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


2-Amino-5-(aminomethyl)phenol, also known as $name$, is a versatile organic compound that finds wide application in chemical synthesis. One key use of this compound is in the production of various polymers and resins. Its unique structure allows it to act as a key building block in the formation of high-performance materials with desirable properties.In chemical synthesis, 2-Amino-5-(aminomethyl)phenol serves as a crucial intermediate in the creation of dyes and pigments. Through various chemical reactions, it can be transformed into a range of vibrant colorants that are used in industries such as textiles, plastics, and coatings. Its presence enables the synthesis of complex molecules that exhibit specific color properties, making it an essential component in the production of colorants for various applications.Furthermore, 2-Amino-5-(aminomethyl)phenol plays a vital role in the development of pharmaceutical compounds. Its chemical properties make it well-suited for incorporation into drug molecules, where it can contribute to the overall efficacy of the medication. By serving as a key structural element in pharmaceutical synthesis, this compound aids in the creation of novel drugs with targeted mechanisms of action.Overall, the application of 2-Amino-5-(aminomethyl)phenol in chemical synthesis is instrumental in the production of a diverse range of materials, from polymers to dyes to pharmaceuticals. Its versatility and reactivity make it a valuable tool for chemists seeking to create innovative compounds with specific properties and functionalities.