1. Home
  2. 1-(4-methoxyphenyl)-4-oxocyclohexane-1-carboxylic acid

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

1-(4-methoxyphenyl)-4-oxocyclohexane-1-carboxylic acid

COc1ccc(cc1)C1(CCC(=O)CC1)C(=O)O Request for Quotation
Chemical Name: 1-(4-methoxyphenyl)-4-oxocyclohexane-1-carboxylic acid
CAS Number: 887978-56-5
Product Number: AG004CT7(AGN-PC-03C9C4)
Synonyms:
MDL No: MFCD06410573
Molecular Formula: C14H16O4
Molecular Weight: 248.2744

Identification/Properties

Safety Information

GHS Pictogram:
N/A
Signal Word:
UN#:
-
Hazard Statements:
-
Precautionary Statements:
Class:
-
Packing Group:
-

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


1-(4-Methoxyphenyl)-4-oxocyclohexanecarboxylic acid is a versatile chemical compound that finds extensive use in various chemical synthesis processes. This compound serves as a key building block in the creation of novel pharmaceuticals, agrochemicals, and materials due to its unique structure and reactivity.In chemical synthesis, 1-(4-Methoxyphenyl)-4-oxocyclohexanecarboxylic acid acts as a crucial intermediate for the preparation of diverse organic compounds. Its functional groups allow for modification and derivatization, enabling the formation of complex molecular structures with specific properties. This compound is commonly employed in medicinal chemistry for the synthesis of potential drug candidates, where its cyclohexane ring and carboxylic acid moiety serve as anchor points for further molecular modifications.Furthermore, the presence of the methoxyphenyl group enhances the compound's solubility and stability in various solvents, making it suitable for reactions under different conditions. By incorporating 1-(4-Methoxyphenyl)-4-oxocyclohexanecarboxylic acid into synthetic pathways, chemists can access a wide range of structurally diverse compounds with potential applications in the fields of pharmaceuticals, agrochemicals, and materials science.