1. Home
  2. ethyl 5-bromo-1-benzofuran-3-carboxylate

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

ethyl 5-bromo-1-benzofuran-3-carboxylate

CCOC(=O)c1coc2c1cc(Br)cc2 Request for Quotation
Chemical Name: ethyl 5-bromo-1-benzofuran-3-carboxylate
CAS Number: 137242-41-2
Product Number: AG0012ZN(AGN-PC-03EGGA)
Synonyms:
MDL No:
Molecular Formula: C11H9BrO3
Molecular Weight: 269.0914

Identification/Properties

Safety Information

GHS Pictogram:
N/A
Signal Word:
UN#:
-
Hazard Statements:
-
Precautionary Statements:
Class:
-
Packing Group:
-

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


Ethyl 5-bromobenzofuran-3-carboxylate is a versatile compound used in chemical synthesis for various applications. This compound is known for its ability to participate in a range of reactions, making it a valuable building block in organic synthesis. It serves as a key intermediate in the preparation of different organic molecules, including pharmaceuticals, agrochemicals, and materials.One of the primary applications of Ethyl 5-bromobenzofuran-3-carboxylate is in the synthesis of biologically active compounds. By incorporating this compound into the chemical reaction, chemists can access new structures and functionalities that are not easily attainable through other routes. This enables the development of novel pharmaceuticals with potential therapeutic benefits.Additionally, Ethyl 5-bromobenzofuran-3-carboxylate can be used in the preparation of functional materials with specific properties. Its unique structure allows for the modification of materials such as polymers, coatings, and dyes, leading to improved performance characteristics. This versatility makes it a valuable tool for material scientists seeking to create innovative products for various industries.Overall, Ethyl 5-bromobenzofuran-3-carboxylate plays a crucial role in chemical synthesis by enabling the efficient and controlled construction of complex molecules. Its diverse applications highlight its importance as a key component in the toolkit of synthetic chemists seeking to explore new frontiers in organic chemistry.