1. Home
  2. 1(2H)-Isoquinolinone, 5-chloro-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

1(2H)-Isoquinolinone, 5-chloro-

Clc1cccc2c1cc[nH]c2=O Request for Quotation
Chemical Name: 1(2H)-Isoquinolinone, 5-chloro-
CAS Number: 24188-73-6
Product Number: AG00CCP4(AGN-PC-03H967)
Synonyms:
MDL No:
Molecular Formula: C9H6ClNO
Molecular Weight: 179.6030

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


5-Chloroisoquinolin-1(2H)-one, commonly referred to as $name$, is a versatile compound that finds wide application in chemical synthesis. Its unique structure and reactivity make it a valuable building block in the creation of various organic molecules.One of the key applications of 5-Chloroisoquinolin-1(2H)-one is in the synthesis of biologically active compounds. Through strategic modifications and functional group manipulations, this compound serves as a precursor for the production of pharmaceuticals, agrochemicals, and other specialized chemicals. Its chloro substitution allows for further derivatization, enabling the synthesis of diverse molecular structures with specific properties and functionalities.Moreover, 5-Chloroisoquinolin-1(2H)-one plays a crucial role in heterocyclic chemistry, where it serves as a core component for the construction of complex aromatic systems. By incorporating this molecule into various synthetic pathways, chemists can access a wide range of heterocyclic frameworks with potential applications in drug discovery, materials science, and other fields.In summary, the application of 5-Chloroisoquinolin-1(2H)-one in chemical synthesis is instrumental in the preparation of sophisticated organic compounds with significant industrial and scientific relevance. Its versatility and reactivity make it a valuable asset in the hands of synthetic chemists seeking to access new chemical space and develop innovative molecules for various purposes.