1. Home
  2. Pyridine, 5-bromo-3-methyl-2-(1-methylethoxy)-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

Pyridine, 5-bromo-3-methyl-2-(1-methylethoxy)-

CC(Oc1ncc(cc1C)Br)C Request for Quotation
Chemical Name: Pyridine, 5-bromo-3-methyl-2-(1-methylethoxy)-
CAS Number: 760207-88-3
Product Number: AG00G9PR(AGN-PC-03RQTP)
Synonyms:
MDL No:
Molecular Formula: C9H12BrNO
Molecular Weight: 230.1017

Identification/Properties

Safety Information

GHS Pictogram:
N/A
Signal Word:
UN#:
-
Hazard Statements:
-
Precautionary Statements:
Class:
-
Packing Group:
-

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


5-Bromo-2-isopropoxy-3-methylpyridine is a versatile chemical compound commonly used in chemical synthesis for various applications. 1. Cross-coupling Reactions:
This compound is frequently employed in cross-coupling reactions, such as Suzuki-Miyaura coupling and Heck coupling. It serves as a valuable starting material for the construction of biaryl compounds or functionalized heterocycles.2. Palladium-Catalyzed Reactions:
Due to its specific structural features, 5-Bromo-2-isopropoxy-3-methylpyridine is well-suited for palladium-catalyzed reactions. It can participate in a range of palladium-catalyzed transformations, including C-H functionalization and carbon-carbon bond formation.3. Medicinal Chemistry:
In the field of medicinal chemistry, this compound can be incorporated into the synthesis of novel drug candidates or analogs. Its unique properties make it useful for modifying biological activity or enhancing pharmacokinetic properties in drug discovery projects.4. Materials Science:
Researchers also utilize 5-Bromo-2-isopropoxy-3-methylpyridine in the preparation of advanced materials, such as organic semiconductors or polymers. By introducing this compound into various synthetic pathways, tailored materials with specific properties can be obtained for electronic or optoelectronic applications.5. Building Block Synthesis:
Overall, 5-Bromo-2-isopropoxy-3-methylpyridine plays a crucial role as a key building block in the synthesis of diverse chemical structures. Its functional groups and reactivity open up opportunities for creating a wide range of compounds with unique properties and functionalities.