1. Home
  2. Carbamic acid, bis(2-hydroxyethyl)-, phenylmethyl ester

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

Carbamic acid, bis(2-hydroxyethyl)-, phenylmethyl ester

OCCN(C(=O)OCc1ccccc1)CCO Request for Quotation
Chemical Name: Carbamic acid, bis(2-hydroxyethyl)-, phenylmethyl ester
CAS Number: 70782-12-6
Product Number: AG00IC3P(AGN-PC-0447ZJ)
Synonyms:
MDL No:
Molecular Formula: C12H17NO4
Molecular Weight: 239.26768

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


Benzyl Bis(2-hydroxyethyl)carbamate, also known as BBHC, is a versatile compound frequently utilized in chemical synthesis due to its unique properties and versatile applications. One prominent application of BBHC in chemical synthesis is its use as a bifunctional crosslinking agent in polymer chemistry. Through its ability to form covalent bonds with multiple functional groups, BBHC plays a crucial role in the synthesis of various polymer networks, enhancing their mechanical strength and stability.Additionally, BBHC is commonly employed as a protective group in organic synthesis reactions. By temporarily masking specific functional groups on molecules, BBHC allows chemists to selectively control chemical reactions and achieve desired outcomes with precision. This protective function of BBHC is particularly advantageous in complex synthesis strategies where multiple steps are involved.Moreover, BBHC also serves as an efficient coupling reagent in peptide synthesis. By facilitating the formation of peptide bonds between amino acids during peptide synthesis, BBHC enables the efficient production of peptides with high purity and yield. Its compatibility with a wide range of solvents and reaction conditions makes BBHC a valuable tool in peptide chemistry.Overall, the diverse applications of Benzyl Bis(2-hydroxyethyl)carbamate in chemical synthesis highlight its significance in modern chemistry research and industrial processes.