1. Home
  2. (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-4-chloro-3-oxobutanenitrile

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

(2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-4-chloro-3-oxobutanenitrile

N#CC(=c1sc2c([nH]1)cccc2)C(=O)CCl Request for Quotation
Chemical Name: (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-4-chloro-3-oxobutanenitrile
CAS Number: 307975-77-5
Product Number: AG019GZ2(AGN-PC-04H9ZB)
Synonyms:
MDL No: MFCD00832012
Molecular Formula: C11H7ClN2OS
Molecular Weight: 250.7041

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


4-Chloro-2-(2,3-dihydro-1,3-benzothiazol-2-ylidene)-3-oxobutanenitrile is a versatile compound widely utilized in chemical synthesis for various applications. 1. Polymer Chemistry: This compound serves as a valuable building block in polymer chemistry, particularly in the synthesis of functional polymers and copolymers. Its unique structure and reactivity make it ideal for introducing specific functional groups into polymer chains, thereby modulating the properties of the resultant materials.2. Medicinal Chemistry: 4-Chloro-2-(2,3-dihydro-1,3-benzothiazol-2-ylidene)-3-oxobutanenitrile has shown promise in medicinal chemistry as a key intermediate in the synthesis of pharmacologically active compounds. Its structural features make it a valuable scaffold for the design and development of new drug candidates targeting various biological pathways.3. Organic Synthesis: In organic synthesis, this compound plays a crucial role in the construction of complex molecular structures through various synthetic pathways. Its versatile reactivity allows for the efficient formation of carbon-carbon and carbon-heteroatom bonds, which are essential in the preparation of organic molecules with diverse functionalities.4. Material Science: Due to its unique structural properties, 4-Chloro-2-(2,3-dihydro-1,3-benzothiazol-2-ylidene)-3-oxobutanenitrile finds applications in material science for the synthesis of advanced materials with tailored properties. By incorporating this compound into material formulations, researchers can develop materials with enhanced performance characteristics for specific applications.