1. Home
  2. sodium;pyrimidine-4-carboxylate

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

sodium;pyrimidine-4-carboxylate

[O-]C(=O)c1ccncn1.[Na+] Request for Quotation
Chemical Name: sodium;pyrimidine-4-carboxylate
CAS Number: 819850-18-5
Product Number: AG0054UJ(AGN-PC-04RZFF)
Synonyms:
MDL No:
Molecular Formula: C5H3N2NaO2
Molecular Weight: 146.0793

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


Pyrimidine-4-carboxylic Acid (sodium salt) is a versatile compound widely used in chemical synthesis. This compound serves as a key building block in the creation of various pharmaceuticals, agrochemicals, and other specialty chemicals. Its unique molecular structure allows it to participate in a wide range of chemical reactions, making it a valuable tool for organic chemists.In chemical synthesis, Pyrimidine-4-carboxylic Acid (sodium salt) can be utilized as a starting material for the construction of complex molecules. It can undergo functional group transformations, such as amidation, esterification, and condensation reactions, to generate novel compounds with tailored properties. Additionally, its presence can influence the reactivity and selectivity of other functional groups within a molecule, enabling precise control over the synthetic process.Furthermore, Pyrimidine-4-carboxylic Acid (sodium salt) can act as a catalyst or a ligand in certain reactions, facilitating the formation of specific chemical bonds or promoting desired stereochemistry. Its ability to engage in both reversible and irreversible reactions makes it an essential component in the design and optimization of synthetic routes for the production of fine chemicals and pharmaceutical intermediates.