1. Home
  2. 5-chloro-1H-imidazo[4,5-b]pyridine-2-carboxylic acid

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

5-chloro-1H-imidazo[4,5-b]pyridine-2-carboxylic acid

Clc1ccc2c(n1)nc([nH]2)C(=O)O Request for Quotation
Chemical Name: 5-chloro-1H-imidazo[4,5-b]pyridine-2-carboxylic acid
CAS Number: 933750-74-4
Product Number: AG0063OF(AGN-PC-04TMDV)
Synonyms:
MDL No:
Molecular Formula: C7H4ClN3O2
Molecular Weight: 197.5786

Identification/Properties

Properties
Storage:
Inert atmosphere;2-8℃;

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


5-Chloro-1H-imidazo[4,5-b]pyridine-2-carboxylic acid is a versatile compound widely utilized in chemical synthesis due to its unique structural properties. Within the realm of organic chemistry, this compound serves as a valuable building block in the synthesis of various heterocyclic compounds and pharmaceutical intermediates. Its specific applications include:1. Heterocyclic Synthesis: 5-Chloro-1H-imidazo[4,5-b]pyridine-2-carboxylic acid can be employed in the construction of complex heterocycles through various ring-forming reactions, such as cyclization, condensation, and functional group transformations.2. Drug Development: As a key intermediate in medicinal chemistry, this compound plays a crucial role in the synthesis of pharmaceutical agents targeting specific biological pathways. Its incorporation in drug design contributes to the development of novel therapeutic compounds.3. Functional Group Manipulation: The presence of a chloro group and a carboxylic acid moiety in the structure of 5-Chloro-1H-imidazo[4,5-b]pyridine-2-carboxylic acid enables diverse functional group interconversions, facilitating the creation of molecular diversity in chemical libraries.4. Bioconjugation Chemistry: This compound can be utilized in the synthesis of bioconjugates for applications in drug delivery, diagnostics, and bioimaging. Its compatibility with bioorthogonal chemistry further expands its utility in biologically relevant systems.5. Polymer Chemistry: By incorporating 5-Chloro-1H-imidazo[4,5-b]pyridine-2-carboxylic acid into polymer chains, novel materials with tailored properties can be synthesized for applications in coatings, adhesives, and electronic devices.Overall, the strategic utilization of 5-Chloro-1H-imidazo[4,5-b]pyridine-2-carboxylic acid in chemical synthesis enables access to diverse molecular architectures with potential applications across multiple scientific disciplines.