1. Home
  2. Benzenamine, 3-fluoro-4-(hexahydro-4-methyl-1H-1,4-diazepin-1-yl)-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

Benzenamine, 3-fluoro-4-(hexahydro-4-methyl-1H-1,4-diazepin-1-yl)-

CN1CCCN(CC1)c1ccc(cc1F)N Request for Quotation
Chemical Name: Benzenamine, 3-fluoro-4-(hexahydro-4-methyl-1H-1,4-diazepin-1-yl)-
CAS Number: 873537-30-5
Product Number: AG008E5S(AGN-PC-05TQNO)
Synonyms:
MDL No:
Molecular Formula: C12H18FN3
Molecular Weight: 223.2898

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


Benzenamine, 3-fluoro-4-(hexahydro-4-methyl-1H-1,4-diazepin-1-yl)-, is a versatile chemical compound widely used in chemical synthesis. This compound plays a crucial role in various synthetic processes, especially in the production of pharmaceuticals and agrochemicals. Its unique structure containing a fluorine atom and a substituted diazepine ring makes it a valuable building block for the creation of complex organic molecules.In chemical synthesis, Benzenamine, 3-fluoro-4-(hexahydro-4-methyl-1H-1,4-diazepin-1-yl)- can be utilized as a key intermediate in the development of novel drug candidates. Its specific structural features confer desirable biological properties to the final compounds, enhancing their efficacy as potential pharmaceutical agents. Moreover, the presence of the fluorine atom provides opportunities for further functionalization, allowing chemists to tailor the compound for specific applications.Furthermore, this compound can also be employed in the synthesis of agrochemicals, where its unique structure can contribute to the design of new pesticides or herbicides. By incorporating Benzenamine, 3-fluoro-4-(hexahydro-4-methyl-1H-1,4-diazepin-1-yl)- into the molecular structure of agrochemical compounds, researchers can enhance their activity and selectivity, leading to more effective crop protection solutions.Overall, Benzenamine, 3-fluoro-4-(hexahydro-4-methyl-1H-1,4-diazepin-1-yl)- is a valuable tool in chemical synthesis, offering diverse possibilities for the creation of innovative pharmaceuticals and agrochemicals. Its strategic placement within complex molecule structures makes it an essential building block for the development of advanced functional materials with potential applications in various industries.