1. Home
  2. 1-[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-2-[4-chloro-5-(hydroxymethyl)-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-2-yl]pentan-1-ol

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

1-[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-2-[4-chloro-5-(hydroxymethyl)-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-2-yl]pentan-1-ol

CCCCc1nc(c(n1Cc1ccc(cc1)c1ccccc1c1nn[nH]n1)C(C(c1nc(c(n1Cc1ccc(cc1)c1ccccc1c1nn[nH]n1)CO)Cl)CCC)O)Cl Request for Quotation
Chemical Name: 1-[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-2-[4-chloro-5-(hydroxymethyl)-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-2-yl]pentan-1-ol
CAS Number: 1159977-48-6
Product Number: AG000HEM(AGN-PC-07Y4OZ)
Synonyms:
MDL No:
Molecular Formula: C44H44Cl2N12O2
Molecular Weight: 843.8054

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


Losartan α-Butyl-losartan Aldehyde Adduct, also known as Losartan Impurity, plays a crucial role in chemical synthesis processes as a byproduct and impurity derived from the synthesis of Losartan, a well-known angiotensin II receptor antagonist used in the treatment of hypertension and other cardiovascular conditions. In chemical synthesis, Losartan Impurity serves not only as a marker for the purity and quality of the final Losartan product but also as a potential intermediate in the synthesis of other pharmaceutical compounds.Losartan Impurity can be utilized in the development and optimization of synthetic routes for Losartan production, enabling chemists to monitor and control the reaction pathways leading to the desired product. By understanding the formation and characteristics of this impurity, chemists can adjust reaction conditions, purification methods, and analytical techniques to enhance the efficiency and yield of Losartan synthesis.Furthermore, Losartan Impurity can also be employed in the synthesis of novel compounds or analogs through reactivity studies and transformation reactions. Its presence can offer insights into the reactivity of specific chemical groups within the Losartan molecule, potentially leading to the discovery of new pharmaceutical candidates with improved therapeutic properties.Overall, Losartan α-Butyl-losartan Aldehyde Adduct, as a significant impurity in the synthesis of Losartan, serves as a valuable tool for chemists in understanding reaction mechanisms, optimizing synthetic processes, and exploring novel chemical transformations in pharmaceutical research and development.