1. Home
  2. 2-Thiazolecarboxylicacid, 4-[4-(trifluoromethyl)phenyl]-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

2-Thiazolecarboxylicacid, 4-[4-(trifluoromethyl)phenyl]-

OC(=O)c1scc(n1)c1ccc(cc1)C(F)(F)F Request for Quotation
Chemical Name: 2-Thiazolecarboxylicacid, 4-[4-(trifluoromethyl)phenyl]-
CAS Number: 886366-98-9
Product Number: AG003HXY(AGN-PC-09ROVY)
Synonyms:
MDL No:
Molecular Formula: C11H6F3NO2S
Molecular Weight: 273.2310

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


2-Thiazolecarboxylic acid, 4-[4-(trifluoromethyl)phenyl]- is a versatile compound commonly used in chemical synthesis as a key building block in the creation of pharmaceuticals, agrochemicals, and materials. This unique compound serves as a crucial intermediate in synthesizing various biologically active molecules due to its structural flexibility and reactivity.In chemical synthesis, 2-Thiazolecarboxylic acid, 4-[4-(trifluoromethyl)phenyl]- can be utilized in the formation of heterocyclic structures, allowing for the introduction of valuable functional groups. Its trifluoromethylphenyl group provides enhanced stability and lipophilicity, making it a valuable component in drug design and discovery processes. Additionally, the thiazole ring confers unique properties that can be leveraged in the development of novel compounds with desirable pharmacological activities.Furthermore, the strategic incorporation of 2-Thiazolecarboxylic acid, 4-[4-(trifluoromethyl)phenyl]- in chemical syntheses can lead to the production of compounds with improved bioavailability, potency, and selectivity, making it an indispensable tool in medicinal chemistry and related fields. Its ability to participate in diverse synthetic transformations opens up a wide range of possibilities for creating innovative molecules with tailored properties for various applications in the pharmaceutical and agricultural sectors.