1. Home
  2. 6-fluoro-1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

6-fluoro-1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid

Fc1cnc2c(c1)[nH]cc2C(=O)O Request for Quotation
Chemical Name: 6-fluoro-1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid
CAS Number: 1190316-18-7
Product Number: AG000HPB(AGN-PC-09RUZE)
Synonyms:
MDL No:
Molecular Formula: C8H5FN2O2
Molecular Weight: 180.1359

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


6-Fluoro-1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid is a versatile compound widely utilized in chemical synthesis for its ability to serve as a key building block in the creation of various organic molecules. Due to its unique chemical structure, this acid is particularly valuable in the development of pharmaceuticals, agrochemicals, and materials science. Its fluorinated moiety enhances the compound's reactivity and selectivity in reactions, making it a valuable tool for the synthesis of complex organic compounds. In pharmaceutical chemistry, this compound can be employed in the creation of novel drug candidates by serving as a core scaffold for the attachment of different functional groups that impart specific biological activities. Its presence in the structure can also lead to improved pharmacokinetic properties of the resulting molecules. Additionally, in materials science, the incorporation of 6-Fluoro-1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid into polymers or other materials can impart unique properties such as increased stability or enhanced performance. This compound's application in chemical synthesis highlights its importance as a foundational reagent for the design and development of diverse organic compounds with potential applications across various industries.