1. Home
  2. 1-O-tert-butyl 4-O-methyl 2-(aminomethyl)imidazole-1,4-dicarboxylate

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

1-O-tert-butyl 4-O-methyl 2-(aminomethyl)imidazole-1,4-dicarboxylate

COC(=O)c1cn(c(n1)CN)C(=O)OC(C)(C)C Request for Quotation
Chemical Name: 1-O-tert-butyl 4-O-methyl 2-(aminomethyl)imidazole-1,4-dicarboxylate
CAS Number: 252348-76-8
Product Number: AG007O0O(AGN-PC-09T6QO)
Synonyms:
MDL No:
Molecular Formula: C11H17N3O4
Molecular Weight: 255.2704

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


N-BOC-2-aminomethyl-imidazole-4-carboxylic acid methyl ester is a versatile compound widely used in chemical synthesis. This molecule plays a crucial role in organic chemistry processes, as it serves as a protective group for the amino functionality. By introducing the BOC (tert-butyloxycarbonyl) group to the amino group, N-BOC-2-aminomethyl-imidazole-4-carboxylic acid methyl ester effectively shields the amino group from unwanted reactions or side reactions during various synthetic procedures.In peptide synthesis, N-BOC-2-aminomethyl-imidazole-4-carboxylic acid methyl ester is commonly employed to protect the N-terminus of amino acids. By attaching the BOC group to the amino group, chemists can selectively control the order of amino acid coupling reactions in peptide assembly. This protective strategy ensures the precise and controlled formation of peptide bonds, leading to the efficient synthesis of complex peptides and proteins.Moreover, N-BOC-2-aminomethyl-imidazole-4-carboxylic acid methyl ester finds application in the preparation of pharmaceutical intermediates, where the selective deprotection of the BOC group enables the manipulation of specific functional groups in target molecules. This compound's versatility and compatibility with various chemical reactions make it a valuable tool in the synthesis of bioactive compounds and drug candidates.Overall, N-BOC-2-aminomethyl-imidazole-4-carboxylic acid methyl ester plays a pivotal role in chemical synthesis by providing chemists with a strategic protective group strategy to facilitate the controlled and efficient construction of complex molecules and pharmaceutical agents.