1. Home
  2. 1-Benzylpyrrolidine-2,5-dicarboxylic acid diethyl ester

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

1-Benzylpyrrolidine-2,5-dicarboxylic acid diethyl ester

CCOC(=O)C1CCC(N1Cc1ccccc1)C(=O)OCC Request for Quotation
Chemical Name: 1-Benzylpyrrolidine-2,5-dicarboxylic acid diethyl ester
CAS Number: 93478-48-9
Product Number: AG00H22M(AGN-PC-0HQECC)
Synonyms:
MDL No:
Molecular Formula: C17H23NO4
Molecular Weight: 305.36882

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


Diethyl 1-benzylpyrrolidine-2,5-dicarboxylate hydrochloride is a crucial compound frequently utilized in chemical synthesis, particularly in the realm of pharmaceutical research and development. This versatile molecule serves as a key building block in the production of various advanced organic compounds, owing to its unique structural properties and reactivity.In chemical synthesis, Diethyl 1-benzylpyrrolidine-2,5-dicarboxylate hydrochloride acts as a critical intermediate in the creation of diverse pharmaceutical agents and therapeutic compounds. Its presence in reaction pathways enables the formation of complex structures that are fundamental to the development of novel drug candidates and biologically active molecules.Due to its distinct chemical characteristics, Diethyl 1-benzylpyrrolidine-2,5-dicarboxylate hydrochloride plays a pivotal role in facilitating key bond formations and transformations during the synthesis of intricate organic chemicals. Its incorporation into synthetic routes allows for the efficient and controlled generation of desired molecular structures, thereby contributing significantly to the advancement of innovative drug design and medicinal chemistry research.