1. Home
  2. 6-methoxy-1-methylbenzimidazol-2-amine

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

6-methoxy-1-methylbenzimidazol-2-amine

COc1ccc2c(c1)n(C)c(n2)N Request for Quotation
Chemical Name: 6-methoxy-1-methylbenzimidazol-2-amine
CAS Number: 945023-35-8
Product Number: AG00IIB2(AGN-PC-0IEWLY)
Synonyms:
MDL No: MFCD23904053
Molecular Formula: C9H11N3O
Molecular Weight: 177.20314

Identification/Properties

Safety Information

GHS Pictogram:
N/A
Signal Word:
UN#:
-
Hazard Statements:
-
Precautionary Statements:
Class:
-
Packing Group:
-

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


2-Amino-6-methoxy-1-methylbenzimidazole is a versatile compound that finds wide application in chemical synthesis, particularly in the pharmaceutical industry. With its unique molecular structure, this compound serves as a valuable building block for the synthesis of various biologically active molecules.In chemical synthesis, 2-Amino-6-methoxy-1-methylbenzimidazole can be utilized as a key intermediate in the production of pharmaceutical compounds, such as antiviral and antibacterial agents. Its presence in the synthesis pathway can impart specific functional groups or stereochemistry necessary for the desired pharmacological activity of the final product.Furthermore, the reactivity of 2-Amino-6-methoxy-1-methylbenzimidazole allows for manipulation through various chemical reactions to introduce diverse substituents or modify its structure to create novel compounds with potentially enhanced biological properties. Its ability to undergo selective transformations makes it a valuable tool for medicinal chemists seeking to develop new drug candidates with improved efficacy and reduced side effects.Overall, the application of 2-Amino-6-methoxy-1-methylbenzimidazole in chemical synthesis plays a crucial role in the development of pharmaceuticals and other biologically active compounds, showcasing its significance in the field of medicinal chemistry and drug discovery.