1. Home
  2. 7-chloro-3-phenyl-1H-pyrazolo[4,3-d]pyrimidine

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

7-chloro-3-phenyl-1H-pyrazolo[4,3-d]pyrimidine

Clc1ncnc2c1[nH]nc2c1ccccc1 Request for Quotation
Chemical Name: 7-chloro-3-phenyl-1H-pyrazolo[4,3-d]pyrimidine
CAS Number: 1211588-84-9
Product Number: AG00A9XR(AGN-PC-0JF42O)
Synonyms:
MDL No:
Molecular Formula: C11H7ClN4
Molecular Weight: 230.65308

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


7-Chloro-3-phenyl-1H-pyrazolo[4,3-d]pyrimidine, commonly known by its chemical name, is a versatile compound widely utilized in chemical synthesis. This compound plays a crucial role in the creation of various pharmaceuticals and agrochemicals due to its structural properties and reactivity.In chemical synthesis, 7-Chloro-3-phenyl-1H-pyrazolo[4,3-d]pyrimidine serves as a key building block in the formation of heterocyclic structures. Its unique molecular structure allows for the incorporation of diverse functional groups and modifications, making it a valuable intermediate in the synthesis of complex organic molecules.One of the primary applications of 7-Chloro-3-phenyl-1H-pyrazolo[4,3-d]pyrimidine is in the development of novel drug molecules. By incorporating this compound into drug design, chemists can enhance the biological activity, stability, and selectivity of pharmaceutical compounds. Additionally, this compound is instrumental in the synthesis of herbicides, fungicides, and other agrochemicals, where its reactivity and functional groups contribute to the desired properties of the final products.Overall, the versatility and reactivity of 7-Chloro-3-phenyl-1H-pyrazolo[4,3-d]pyrimidine make it an indispensable tool in chemical synthesis, enabling the creation of diverse compounds with applications in the pharmaceutical and agricultural industries.