1. Home
  2. 5-bromo-4-chloropyridin-3-ol

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

5-bromo-4-chloropyridin-3-ol

Clc1c(O)cncc1Br Request for Quotation
Chemical Name: 5-bromo-4-chloropyridin-3-ol
CAS Number: 1256813-87-2
Product Number: AG000OFK(AGN-PC-0JF42R)
Synonyms:
MDL No:
Molecular Formula: C5H3BrClNO
Molecular Weight: 208.4404

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


5-Bromo-4-chloropyridin-3-ol is a versatile chemical compound commonly used in various chemical synthesis applications. This compound serves as a valuable building block in the production of pharmaceuticals, agrochemicals, and other fine chemicals. Its unique structure and reactivity make it an essential ingredient in the synthesis of complex molecules with diverse functionalities.In chemical synthesis, 5-Bromo-4-chloropyridin-3-ol can be employed as a key intermediate for the modification of organic molecules. Its halogen substituents (bromo and chloro groups) offer opportunities for selective functionalization through cross-coupling reactions, nucleophilic substitution, and other transformation processes. These reactions enable the introduction of specific functional groups at strategic positions, allowing chemists to tailor the properties of the final compound for various purposes.Furthermore, the presence of the pyridine ring in 5-Bromo-4-chloropyridin-3-ol confers unique aromatic and basic properties, which can influence the reactivity and selectivity of chemical reactions. This structural feature makes the compound a valuable scaffold for designing novel molecules with desired biological activities or physical properties.Overall, 5-Bromo-4-chloropyridin-3-ol plays a crucial role in the field of chemical synthesis by enabling the efficient construction of complex molecules with tailored functionalities. Its versatile nature and synthetic utility make it an indispensable tool for researchers and chemists working in drug discovery, materials science, and other areas of chemical research.