1. Home
  2. Benzenamine, 4-chloro-2,6-dinitro-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

Benzenamine, 4-chloro-2,6-dinitro-

Clc1cc([N+](=O)[O-])c(c(c1)[N+](=O)[O-])N Request for Quotation
Chemical Name: Benzenamine, 4-chloro-2,6-dinitro-
CAS Number: 5388-62-5
Product Number: AG003L2W(AGN-PC-0JKFWY)
Synonyms:
MDL No:
Molecular Formula: C6H4ClN3O4
Molecular Weight: 217.5667

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


4-Chloro-2,6-dinitroaniline, also known as CDNA, is a versatile compound widely utilized in chemical synthesis. This compound serves as a crucial building block in the production of various chemical intermediates and final products. In the realm of organic chemistry, 4-Chloro-2,6-dinitroaniline is particularly valued for its role as a key precursor in the synthesis of dyes, pigments, agricultural chemicals, and pharmaceuticals.One of the primary applications of 4-Chloro-2,6-dinitroaniline is in the manufacturing of dyes and pigments. Due to its unique chemical structure and properties, CDNA is able to impart vibrant colors and desirable characteristics to a wide range of products. Additionally, this compound plays a significant role in the development of specialized dyes for applications in textiles, plastics, and coatings.Furthermore, 4-Chloro-2,6-dinitroaniline is utilized in the synthesis of agricultural chemicals such as herbicides and pesticides. By incorporating CDNA into the molecular structure of these compounds, chemists can enhance their efficacy and specificity, leading to improved crop protection and increased agricultural productivity.In the pharmaceutical industry, 4-Chloro-2,6-dinitroaniline acts as a key intermediate in the synthesis of various drug molecules. Its versatility and reactivity make it a valuable building block for creating pharmaceutical compounds with diverse therapeutic properties.Overall, the application of 4-Chloro-2,6-dinitroaniline in chemical synthesis spans across multiple industries, driving innovation and enabling the production of a wide array of valuable products essential for modern society.