1. Home
  2. 5-Amino-1H-pyrazole-4-carboxylic acid ethyl ester

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

5-Amino-1H-pyrazole-4-carboxylic acid ethyl ester

CCOC(=O)c1cn[nH]c1N Request for Quotation
Chemical Name: 5-Amino-1H-pyrazole-4-carboxylic acid ethyl ester
CAS Number: 103259-35-4
Product Number: AG009609(AGN-PC-0JLT9S)
Synonyms:
MDL No:
Molecular Formula: C6H9N3O2
Molecular Weight: 155.15456

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


Ethyl 5-amino-1H-pyrazole-4-carboxylate is a versatile compound widely used in chemical synthesis due to its unique structural properties and reactivity. This compound serves as a key building block in the development of various pharmaceuticals, agrochemicals, and functional materials.In chemical synthesis, Ethyl 5-amino-1H-pyrazole-4-carboxylate acts as a crucial intermediate in the production of diverse organic compounds. Its amino and carboxylate functional groups provide ample opportunities for derivatization and further reactions, allowing for the creation of complex molecular structures. This compound's pyrazole ring imparts desirable properties to the final products, making it valuable for the design and synthesis of bioactive molecules.Researchers leverage the synthetic potential of Ethyl 5-amino-1H-pyrazole-4-carboxylate to access novel compounds with potential applications in drug discovery, materials science, and chemical biology. By incorporating this building block into their synthetic routes, chemists can efficiently access a wide range of functionalized molecules that exhibit diverse biological activities or material properties.