1. Home
  2. 1H-Pyrrole-2,5-dione, 1-[4-(phenylazo)phenyl]-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

1H-Pyrrole-2,5-dione, 1-[4-(phenylazo)phenyl]-

O=C1C=CC(=O)N1c1ccc(cc1)N=Nc1ccccc1 Request for Quotation
Chemical Name: 1H-Pyrrole-2,5-dione, 1-[4-(phenylazo)phenyl]-
CAS Number: 16201-96-0
Product Number: AG001SMZ(AGN-PC-0JLVMC)
Synonyms:
MDL No:
Molecular Formula: C16H11N3O2
Molecular Weight: 277.2774

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


1-[4-(2-Phenyldiazenyl)phenyl]-1H-pyrrole-2,5-dione, also known as $name$, is a versatile compound widely used in chemical synthesis. This specific molecule offers unique properties that make it valuable in various synthetic processes. One key application of $name$ in chemical synthesis is as a reagent for oxidative coupling reactions. By leveraging the diazenyl functional group and the pyrrole-dione core structure, $name$ serves as an efficient mediator for forming carbon-carbon bonds in complex organic molecules. Its ability to participate in both radical and electrophilic aromatic substitutions makes it a valuable tool in the construction of diverse molecular architectures. Additionally, the presence of the phenyl groups in the molecule enhances its reactivity and selectivity in different coupling reactions, allowing for precise control over the synthetic pathways. Chemists rely on the unique characteristics of $name$ to access novel compounds and functional materials through strategic chemical transformations, highlighting its significance in advancing synthetic methodologies and expanding the scope of chemical synthesis.