1. Home
  2. Propanoic acid, 2,2-dichloro-, methyl ester

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

Propanoic acid, 2,2-dichloro-, methyl ester

COC(=O)C(Cl)(Cl)C Request for Quotation
Chemical Name: Propanoic acid, 2,2-dichloro-, methyl ester
CAS Number: 17640-02-7
Product Number: AG01E2SM(AGN-PC-0JLWN0)
Synonyms:
MDL No:
Molecular Formula: C4H6Cl2O2
Molecular Weight: 156.99524

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


Propanoic acid, 2,2-dichloro-, methyl ester is a versatile chemical compound commonly used in chemical synthesis processes. It serves as a crucial intermediate in the production of various organic compounds due to its unique chemical properties.This compound is frequently employed in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals. Its reactivity and stability make it an ideal building block for the creation of complex molecules in the pharmaceutical industry. Additionally, in agrochemical synthesis, propanoic acid, 2,2-dichloro-, methyl ester plays a significant role in the development of pesticides and herbicides.Its ability to undergo various chemical reactions, such as esterification, hydrolysis, and nucleophilic substitution, makes it a valuable tool for organic chemists and researchers. Furthermore, its specific structure allows for precise control over the stereochemistry of the final products in asymmetric synthesis reactions.Overall, propanoic acid, 2,2-dichloro-, methyl ester is indispensable in the realm of chemical synthesis, enabling the creation of diverse and complex molecules essential for numerous industries.