1. Home
  2. Benzoic acid, 4-nitro-, 4-nitrophenyl ester

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

Benzoic acid, 4-nitro-, 4-nitrophenyl ester

O=C(c1ccc(cc1)[N+](=O)[O-])Oc1ccc(cc1)[N+](=O)[O-] Request for Quotation
Chemical Name: Benzoic acid, 4-nitro-, 4-nitrophenyl ester
CAS Number: 1037-31-6
Product Number: AG008U0I(AGN-PC-0JMHYX)
Synonyms:
MDL No:
Molecular Formula: C13H8N2O6
Molecular Weight: 288.21242

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


4-Nitrophenyl-4-nitrobenzoate, also known as $name$, is a versatile compound widely used in chemical synthesis for its unique properties. This compound serves as a crucial building block in the creation of various pharmaceuticals, agrochemicals, and dyes. Its ability to undergo nucleophilic substitution reactions makes it a valuable intermediate in organic synthesis. In particular, 4-Nitrophenyl-4-nitrobenzoate is commonly employed in the preparation of complex organic molecules with intricate structures. Its presence in the synthesis process enables chemists to introduce specific functional groups and modify chemical properties, leading to the development of novel compounds with diverse applications. Additionally, the controlled manipulation of 4-Nitrophenyl-4-nitrobenzoate's structure allows for the production of tailored molecules tailored to meet specific industry needs. Its versatility and reactivity make it an indispensable tool in the field of chemical synthesis, driving innovation and advancement in various sectors.