1. Home
  2. Quinoline, 3-ethyl-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

Quinoline, 3-ethyl-

CCc1cnc2c(c1)cccc2 Request for Quotation
Chemical Name: Quinoline, 3-ethyl-
CAS Number: 1873-54-7
Product Number: AG007RY2(AGN-PC-0JMPCW)
Synonyms:
MDL No:
Molecular Formula: C11H11N
Molecular Weight: 157.2117

Identification/Properties

Safety Information

GHS Pictogram:
N/A
Signal Word:
UN#:
-
Hazard Statements:
-
Precautionary Statements:
Class:
-
Packing Group:
-

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


3-Ethylquinoline is a powerful chemical compound that plays a crucial role in various chemical synthesis processes. This versatile molecule is primarily used as a building block in the creation of a wide range of pharmaceuticals, agrochemicals, and other specialty chemicals. Its unique structure and reactive properties make it a valuable intermediate in the synthesis of complex organic compounds.In chemical synthesis, 3-Ethylquinoline serves as a key precursor for the production of heterocyclic compounds, which are essential in the development of advanced materials and pharmaceuticals. Its presence in the synthesis pathway allows for the introduction of specific functional groups and structural motifs, providing chemists with precise control over the molecular design of the final product.Furthermore, 3-Ethylquinoline is particularly useful in the development of new drug candidates, where its incorporation can enhance the biological activity, stability, and pharmacokinetic properties of the resulting molecules. By selectively modifying the quinoline core using various synthetic strategies, researchers can design compounds with improved efficacy and reduced side effects.Overall, the application of 3-Ethylquinoline in chemical synthesis offers chemists a powerful tool for the creation of innovative molecules with diverse applications in the fields of pharmaceuticals, materials science, and agrochemicals. Its versatility and reactivity make it an indispensable component in the toolbox of synthetic chemists seeking to push the boundaries of molecular design and discovery.