1. Home
  2. 3-Pyridinecarbonitrile, 4,6-dimethyl-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

3-Pyridinecarbonitrile, 4,6-dimethyl-

Cc1cc(C)ncc1C#N Request for Quotation
Chemical Name: 3-Pyridinecarbonitrile, 4,6-dimethyl-
CAS Number: 6623-21-8
Product Number: AG00FB3N(AGN-PC-0JOHNF)
Synonyms:
MDL No:
Molecular Formula: C8H8N2
Molecular Weight: 132.1625

Identification/Properties

Properties
MP:
57-58°C
BP:
251°C at 760 mmHg
Storage:
Inert atmosphere;Room Temperature;
Form:
Solid

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


4,6-Dimethylnicotinonitrile, also known as DMNN, is a versatile chemical compound widely used in pharmaceutical and agrochemical industries for its role in chemical synthesis. This specific derivative of nicotinonitrile is valued for its ability to serve as a key intermediate in the production of various pharmaceuticals and agrochemicals, owing to its unique chemical properties. One of the primary applications of 4,6-Dimethylnicotinonitrile lies in its role as a building block for the synthesis of complex organic molecules. Its structural features make it a valuable precursor for the creation of diverse compounds that exhibit biological activity or agricultural benefits. By serving as a starting material, DMNN enables chemists to efficiently construct novel molecules with enhanced properties, which can have promising applications in drug discovery and crop protection.Moreover, 4,6-Dimethylnicotinonitrile is utilized in the synthesis of various heterocyclic compounds, which are crucial components of many pharmaceuticals and agrochemicals. Its functional groups and reactivity make it a valuable reagent for forming these heterocycles, which are characterized by a ring structure containing atoms of different elements such as nitrogen, oxygen, or sulfur. These heterocyclic compounds often possess diverse biological activities, making them essential targets in the field of medicinal chemistry and agriculture.Additionally, DMNN can also participate in multi-step synthetic pathways to produce target molecules with specific properties. Its compatibility with a wide range of chemical reactions allows for versatile transformations, enabling the creation of intricate structures that are essential for the development of new pharmaceutical agents or crop protection products. Overall, the use of 4,6-Dimethylnicotinonitrile in chemical synthesis demonstrates its significance in facilitating the production of valuable compounds with potential applications in various industries.