1. Home
  2. 3-ethoxy-5-methylbenzoic acid

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

3-ethoxy-5-methylbenzoic acid

CCOc1cc(C)cc(c1)C(=O)O Request for Quotation
Chemical Name: 3-ethoxy-5-methylbenzoic acid
CAS Number: 500901-64-4
Product Number: AG00IM97(AGN-PC-0JOM0Q)
Synonyms:
MDL No: MFCD27940681
Molecular Formula: C10H12O3
Molecular Weight: 180.2005

Identification/Properties

Safety Information

GHS Pictogram:
Signal Word:
Warning
UN#:
N/A
Hazard Statements:
H302-H315-H319-H335
Precautionary Statements:
P261-P280-P301+P312-P302+P352-P305+P351+P338
Class:
N/A
Packing Group:
N/A

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


3-Ethoxy-5-methylbenzoic acid, also known as ethyl 3-ethoxy-5-methylbenzoate, is a versatile chemical compound that finds wide application in chemical synthesis processes. This compound serves as an important building block in the creation of various pharmaceuticals, agrochemicals, and materials due to its unique structural properties.In chemical synthesis, 3-Ethoxy-5-methylbenzoic acid is primarily utilized as a key intermediate in the synthesis of complex organic molecules. It can undergo various chemical reactions to introduce functional groups and structural motifs, making it a valuable tool for chemists and researchers in designing and producing new compounds.One key application of 3-Ethoxy-5-methylbenzoic acid is in the pharmaceutical industry, where it is used in the synthesis of drug candidates and active pharmaceutical ingredients (APIs). By incorporating this compound into the molecular structure of pharmaceutical compounds, researchers can enhance their biological activity, improve their pharmacokinetic properties, and optimize their overall efficacy.Additionally, 3-Ethoxy-5-methylbenzoic acid plays a crucial role in the development of agrochemicals, such as pesticides and herbicides. Its chemical reactivity allows for the modification of pesticide molecules to improve their selectivity, potency, and environmental safety, contributing to the advancement of sustainable agricultural practices.Furthermore, this compound can be employed in the synthesis of various materials, including specialty chemicals, polymers, and fine chemicals. Its ability to participate in diverse chemical transformations makes it a valuable tool for designing new materials with tailored properties for specific industrial applications.Overall, 3-Ethoxy-5-methylbenzoic acid is a versatile compound with broad applications in chemical synthesis, enabling the creation of innovative molecules with diverse functionalities and applications in pharmaceuticals, agrochemicals, and materials science.