1. Home
  2. Benzenesulfonic acid, 4-methyl-, (1-phenylpropylidene)hydrazide

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

Benzenesulfonic acid, 4-methyl-, (1-phenylpropylidene)hydrazide

CCC(=NNS(=O)(=O)c1ccc(cc1)C)c1ccccc1 Request for Quotation
Chemical Name: Benzenesulfonic acid, 4-methyl-, (1-phenylpropylidene)hydrazide
CAS Number: 17336-66-2
Product Number: AG001YU4(AGN-PC-0JP4X7)
Synonyms:
MDL No:
Molecular Formula: C16H18N2O2S
Molecular Weight: 302.3913

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


1-Propiophenone tosylhydrazone is a versatile compound widely used in chemical synthesis for its ability to serve as a key building block in various transformations and reactions. This compound plays a crucial role in the preparation of diverse organic molecules and serves as a valuable intermediate in the synthesis of pharmaceuticals, agrochemicals, and advanced materials.In organic chemistry, 1-Propiophenone tosylhydrazone acts as a powerful nucleophile that readily participates in various substitution and addition reactions. Its unique structure enables it to undergo nucleophilic additions with electrophiles, facilitating the formation of complex organic compounds. Additionally, this compound can serve as a key precursor for the synthesis of heterocycles, which are essential structural motifs in many bioactive compounds.Furthermore, 1-Propiophenone tosylhydrazone is commonly employed in the preparation of chiral auxiliaries and ligands for asymmetric synthesis. Its ability to undergo chirality transfer reactions makes it a valuable tool for the creation of enantiomerically pure compounds, crucial in the pharmaceutical industry for the development of new drugs with improved biological activity.Overall, the application of 1-Propiophenone tosylhydrazone in chemical synthesis is essential for the efficient construction of diverse organic molecules with high complexity and structural diversity. Its versatility and reactivity make it a valuable reagent for synthetic chemists working on the development of novel compounds with potential applications in various fields.