1. Home
  2. 1H-Indol-5-ol, 3-[2-(methylamino)ethyl]-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

1H-Indol-5-ol, 3-[2-(methylamino)ethyl]-

CNCCc1c[nH]c2c1cc(O)cc2 Request for Quotation
Chemical Name: 1H-Indol-5-ol, 3-[2-(methylamino)ethyl]-
CAS Number: 1134-01-6
Product Number: AG0008FH(AGN-PC-0JPI4M)
Synonyms:
MDL No:
Molecular Formula: C11H14N2O
Molecular Weight: 190.2417

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


N-Methylserotonin, also known as 5-Methoxy-N-methyltryptamine, is a valuable compound with diverse applications in chemical synthesis. As a derivative of serotonin, N-Methylserotonin exhibits unique properties that make it a versatile building block in the production of various pharmaceuticals and organic compounds.In chemical synthesis, N-Methylserotonin serves as a crucial intermediate for the creation of novel drug candidates and research molecules. Its structural characteristics make it an ideal precursor for the modification and functionalization of organic molecules, allowing chemists to generate a wide range of derivatives with tailored properties.By incorporating N-Methylserotonin into synthetic pathways, chemists can access analogs and derivatives that exhibit enhanced biological activity, improved pharmacokinetic profiles, or specific chemical reactivity. This flexibility makes N-Methylserotonin a valuable tool for drug discovery efforts and the development of new therapeutic agents targeting diverse biological pathways.Additionally, the unique pharmacological properties of N-Methylserotonin have led to its investigation in various research fields, including neuroscience, medicinal chemistry, and drug design. By leveraging its structural features and pharmacological effects, researchers can explore the potential applications of N-Methylserotonin in studying neurotransmitter systems, receptor interactions, and drug-receptor interactions.Overall, the versatility and utility of N-Methylserotonin in chemical synthesis make it an indispensable compound for advancing scientific research, drug development, and the creation of innovative molecules with potential therapeutic benefits.