1. Home
  2. 3-Pyridinecarboxamide, N-(2-aminoethyl)-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

3-Pyridinecarboxamide, N-(2-aminoethyl)-

NCCNC(=O)c1cccnc1 Request for Quotation
Chemical Name: 3-Pyridinecarboxamide, N-(2-aminoethyl)-
CAS Number: 939-53-7
Product Number: AG00J34D(AGN-PC-0JT3A5)
Synonyms:
MDL No:
Molecular Formula: C8H11N3O
Molecular Weight: 165.1924

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


N-(2-aminoethyl)nicotinamide, also known as $name$, plays a crucial role in chemical synthesis as a versatile building block. This compound is frequently utilized in the production of various pharmaceuticals and organic compounds due to its unique chemical properties. In organic synthesis, $name$ serves as a key intermediate for the modification of organic molecules, enabling the introduction of functional groups and the creation of new chemical entities. Its amino and nicotinamide functionalities provide diverse reactivity, allowing for selective derivatization and molecular transformations. Additionally, $name$ can act as a chelating agent, facilitating coordination chemistry and metal complex formation in synthetic routes. Its strategic placement of reactive sites offers opportunities for controlled bond formation and intricate structural modifications in chemical reactions. Overall, the application of N-(2-aminoethyl)nicotinamide in chemical synthesis contributes significantly to the development of innovative compounds with potential pharmacological and industrial relevance.