1. Home
  2. 2-Furancarboxylic acid, 5-(4-chloro-2-nitrophenyl)-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

2-Furancarboxylic acid, 5-(4-chloro-2-nitrophenyl)-

Clc1ccc(c(c1)[N+](=O)[O-])c1ccc(o1)C(=O)O Request for Quotation
Chemical Name: 2-Furancarboxylic acid, 5-(4-chloro-2-nitrophenyl)-
CAS Number: 95611-88-4
Product Number: AG003M5F(AGN-PC-0JUYLY)
Synonyms:
MDL No:
Molecular Formula: C11H6ClNO5
Molecular Weight: 267.6220

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


5-(4-Chloro-2-nitrophenyl)-2-furoic acid, also known as $name$, is a key intermediate used in chemical synthesis for its versatile applications. This compound plays a crucial role in organic chemistry as a building block for the synthesis of various pharmaceuticals, agrochemicals, and other fine chemicals.One of the primary applications of $name$ in chemical synthesis is its use as a precursor in the synthesis of heterocyclic compounds. By leveraging the unique structural features of 5-(4-Chloro-2-nitrophenyl)-2-furoic acid, chemists can efficiently access a wide range of complex molecules with diverse biological activities. The presence of both a nitro group and a chloro substituent in the molecule allows for strategic functional group transformations, enabling the synthesis of target compounds with high selectivity and efficiency.Moreover, 5-(4-Chloro-2-nitrophenyl)-2-furoic acid serves as a valuable starting material for the preparation of analogs and derivatives with improved properties. Through various chemical reactions and synthetic manipulations, researchers can modify the structure of $name$ to fine-tune the physicochemical characteristics and biological effects of the resulting compounds. This molecular customization is essential in drug discovery and development, where small structural changes can lead to significant enhancements in potency, selectivity, and other key parameters.Overall, the utilization of 5-(4-Chloro-2-nitrophenyl)-2-furoic acid in chemical synthesis underscores its importance as a versatile building block in the creation of novel molecules with potential applications in the fields of medicine, agriculture, and materials science.