1. Home
  2. Benzoic acid, 2-(4-methoxyphenoxy)-5-nitro-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

Benzoic acid, 2-(4-methoxyphenoxy)-5-nitro-

COc1ccc(cc1)Oc1ccc(cc1C(=O)O)[N+](=O)[O-] Request for Quotation
Chemical Name: Benzoic acid, 2-(4-methoxyphenoxy)-5-nitro-
CAS Number: 33459-12-0
Product Number: AG007FBF(AGN-PC-0KLBDJ)
Synonyms:
MDL No: MFCD00052264
Molecular Formula: C14H11NO6
Molecular Weight: 289.2402

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


The Benzoic acid, 2-(4-methoxyphenoxy)-5-nitro- is a versatile compound widely used in chemical synthesis processes. This compound plays a crucial role in organic reactions and serves as a key building block for the preparation of various derivatives. Its unique chemical structure, featuring both nitro and methoxy functional groups, imparts specific properties that are valuable in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. In organic synthesis, the presence of the nitro group allows for selective reduction reactions, enabling the efficient modification of the molecule to create new compounds with diverse properties.Additionally, the methoxy group adds steric hindrance and electron-donating effects, influencing the reactivity and selectivity of the compound in various reactions. The combination of these functional groups makes Benzoic acid, 2-(4-methoxyphenoxy)-5-nitro- a valuable intermediate in the production of complex molecules with specific biological or industrial applications.Overall, this compound serves as a crucial building block in the realm of chemical synthesis, offering chemists a versatile tool for creating a wide range of new materials and compounds with tailored properties and functionalities.