1. Home
  2. 1,4-Benzenedimethanol, 2-[(2-ethylhexyl)oxy]-5-methoxy-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

1,4-Benzenedimethanol, 2-[(2-ethylhexyl)oxy]-5-methoxy-

CCCCC(COc1cc(CO)c(cc1CO)OC)CC Request for Quotation
Chemical Name: 1,4-Benzenedimethanol, 2-[(2-ethylhexyl)oxy]-5-methoxy-
CAS Number: 245731-58-2
Product Number: AG002OMY(AGN-PC-0L5CR7)
Synonyms:
MDL No:
Molecular Formula: C17H28O4
Molecular Weight: 296.4018

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


1,4-Benzenedimethanol, 2-[(2-ethylhexyl)oxy]-5-methoxy-, is a versatile compound widely utilized in chemical synthesis processes. This compound, known for its unique structure and properties, plays a crucial role in various applications within the field of chemistry.In chemical synthesis, 1,4-Benzenedimethanol, 2-[(2-ethylhexyl)oxy]-5-methoxy- serves as a key intermediate in the production of polymers, resins, and specialty chemicals. Its functional groups enable it to participate in a range of reactions, including esterification, etherification, and polymerization, making it a valuable building block for creating complex molecular structures.One of the significant applications of this compound is in the synthesis of surface-active agents and surfactants. By incorporating 1,4-Benzenedimethanol, 2-[(2-ethylhexyl)oxy]-5-methoxy- into the chemical structure of these compounds, unique surfactant properties such as wetting, emulsifying, and dispersing capabilities can be imparted, enhancing their performance in various industrial and household products.Furthermore, this compound finds use in the formulation of adhesives, coatings, and functional materials. Its compatibility with a wide range of chemical functionalities and its ability to modify material properties make it a versatile ingredient in the development of specialized coatings, adhesives with specific bonding characteristics, and functional materials tailored for specific applications.Overall, 1,4-Benzenedimethanol, 2-[(2-ethylhexyl)oxy]-5-methoxy- is a valuable compound in chemical synthesis, offering unique properties that enable its utilization across diverse industries and applications. Its versatility and functional groups make it a valuable tool for chemists and researchers seeking to develop innovative materials and chemicals.