1. Home
  2. Bromo-[4-(1-piperidylmethyl)phenyl]magnesium

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

Bromo-[4-(1-piperidylmethyl)phenyl]magnesium

Br[Mg]c1ccc(cc1)CN1CCCCC1 Request for Quotation
Chemical Name: Bromo-[4-(1-piperidylmethyl)phenyl]magnesium
CAS Number: 480424-83-7
Product Number: AG00DCLY(AGN-PC-0OASH3)
Synonyms:
MDL No:
Molecular Formula: C12H16BrMgN
Molecular Weight: 278.47114

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


Bromo[4-(1-piperidinylmethyl)phenyl]magnesium, also known as $name$, is a valuable reagent in chemical synthesis due to its versatile applications. This compound plays a crucial role in organic chemistry as a powerful nucleophilic agent capable of participating in a wide range of synthetic transformations.Its primary function lies in its ability to undergo nucleophilic addition reactions with various electrophiles. By serving as a source of the bromide anion, which is highly reactive and can easily attack electrophilic centers, $name$ facilitates the formation of new carbon-carbon or carbon-heteroatom bonds. This enables the synthesis of complex organic molecules with specific structural motifs.Moreover, the piperidine moiety in the molecular structure of $name$ imparts specific properties that can influence the reactivity and selectivity of the reagent in a given chemical reaction. The presence of the piperidine ring can enhance the solubility of the compound in certain solvents or improve its compatibility with specific reaction conditions.Overall, Bromo[4-(1-piperidinylmethyl)phenyl]magnesium is a versatile tool in the hands of synthetic chemists, offering a means to construct intricate molecular frameworks through controlled and selective chemical transformations. Its application in various synthetic methodologies underscores its significance as a valuable building block in organic synthesis.