1. Home
  2. 5,8,10-Heptadecatrienoic acid, 12-hydroxy-, (5Z,8E,10E,12S)-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

5,8,10-Heptadecatrienoic acid, 12-hydroxy-, (5Z,8E,10E,12S)-

CCCCC[C@@H](/C=C/C=C/C/C=CCCCC(=O)O)O Request for Quotation
Chemical Name: 5,8,10-Heptadecatrienoic acid, 12-hydroxy-, (5Z,8E,10E,12S)-
CAS Number: 54397-84-1
Product Number: AG01DPKD(AGN-PC-0OC1UQ)
Synonyms:
MDL No: MFCD00057833
Molecular Formula: C17H28O3
Molecular Weight: 280.40242

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


The 12S-Hydroxy-5Z,8E,10E-heptadecatrienoic acid, known for its high purity and exceptional quality, is a versatile compound widely utilized in various chemical synthesis processes. This compound serves as a key building block in the manufacturing of specialized organic compounds through its unique chemical properties and reactivity. In the realm of chemical synthesis, 12S-Hydroxy-5Z,8E,10E-heptadecatrienoic acid plays a crucial role in the creation of complex structures and functional groups, enabling the production of a diverse range of compounds with specific applications across industries such as pharmaceuticals, agrochemicals, and materials science. Its ability to participate in various reactions and transformations makes it a valuable tool for chemists and researchers seeking to design and construct novel molecules for a wide array of purposes.