1. Home
  2. 2(1H)-Pyrimidinone,4-amino-1-(2-deoxy-2,2-difluoro-D-threo-pentofuranosyl)-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

2(1H)-Pyrimidinone,4-amino-1-(2-deoxy-2,2-difluoro-D-threo-pentofuranosyl)-

OCC1OC(C(C1O)(F)F)n1ccc(nc1=O)N Request for Quotation
Chemical Name: 2(1H)-Pyrimidinone,4-amino-1-(2-deoxy-2,2-difluoro-D-threo-pentofuranosyl)-
CAS Number: 103882-85-5
Product Number: AG007FCR(AGN-PC-0OSO0I)
Synonyms:
MDL No:
Molecular Formula: C9H11F2N3O4
Molecular Weight: 263.1981

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


3'-Epi Gemcitabine, also known as Gemcitabine Impurity, serves a crucial role in chemical synthesis processes. This organic compound is commonly utilized as a reference standard in quality control testing for the pharmaceutical industry. Its unique structure and properties make it a valuable tool in the identification and quantification of Gemcitabine, a widely used cancer medication.In chemical synthesis, 3'-Epi Gemcitabine plays a significant role as a precursor or intermediate in the production of pharmaceutical compounds related to Gemcitabine. Its presence can impact the purity and efficacy of the final product, making it essential for researchers and chemists to monitor and control its concentration during synthesis.Furthermore, the distinct reactivity and behavior of 3'-Epi Gemcitabine in various reaction conditions make it an indispensable component in the optimization and development of synthetic routes. By understanding its mechanisms and interactions in chemical processes, scientists can refine and improve the efficiency of pharmaceutical production, ultimately leading to better quality drugs for patients in need.