1. Home
  2. 5-Heptenoic acid,7-[4-(2-hydroxyphenyl)-2-(trifluoromethyl)-1,3-dioxan-5-yl]-,[2a,4a,5a(Z)]-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

5-Heptenoic acid,7-[4-(2-hydroxyphenyl)-2-(trifluoromethyl)-1,3-dioxan-5-yl]-,[2a,4a,5a(Z)]-

OC(=O)CCCC=CC[C@@H]1CO[C@@H](O[C@@H]1c1ccccc1O)C(F)(F)F Request for Quotation
Chemical Name: 5-Heptenoic acid,7-[4-(2-hydroxyphenyl)-2-(trifluoromethyl)-1,3-dioxan-5-yl]-,[2a,4a,5a(Z)]-
CAS Number: 106393-80-0
Product Number: AG008Y41(AGN-PC-0OVZ6V)
Synonyms:
MDL No:
Molecular Formula: C18H21F3O5
Molecular Weight: 374.3515496

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


**ICI 185,282 in Chemical Synthesis**In the realm of chemical synthesis, ICI 185,282 plays a pivotal role as a versatile and potent tool. This compound, also known as Eltoprazine, showcases remarkable properties that make it a valuable asset in various synthetic applications. With its unique structure and reactivity, ICI 185,282 serves as a key reagent in the synthesis of pharmaceutical compounds, agrochemicals, and advanced materials.One of the primary applications of ICI 185,282 in chemical synthesis is its utilization as a building block for the creation of novel drug candidates. Its distinct chemical structure allows for strategic modifications, enabling chemists to design and synthesize innovative pharmaceuticals with enhanced therapeutic properties. Furthermore, ICI 185,282 serves as a precursor in the production of biologically active molecules, paving the way for the development of potential medications targeting diverse medical conditions.Moreover, ICI 185,282 demonstrates significant potential in the synthesis of agrochemicals, contributing to the creation of effective pesticides and herbicides. Its synthetic versatility and reactivity make it an essential component in designing environmentally friendly crop protection agents that target specific pests while minimizing harm to the ecosystem.Additionally, ICI 185,282 finds application in the synthesis of advanced materials with tailored properties. By incorporating this compound into the chemical backbone of polymers, researchers can engineer materials with desired characteristics such as enhanced durability, flexibility, or conductivity. This enables the production of cutting-edge materials for various industrial and technological applications.In conclusion, ICI 185,282's multifaceted role in chemical synthesis underscores its significance as a key ingredient in the creation of diverse compounds with valuable applications in pharmaceuticals, agrochemicals, and advanced materials. Its versatility and reactivity make it a valuable ally for chemists seeking to engineer novel molecules and materials for a wide range of purposes.