1. Home
  2. 2-Propanol,1-chloro-3-[4-[1-methyl-1-[4-(oxiranylmethoxy)phenyl]ethyl]phenoxy]-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

2-Propanol,1-chloro-3-[4-[1-methyl-1-[4-(oxiranylmethoxy)phenyl]ethyl]phenoxy]-

CC(c1ccc(cc1)O)(c1ccc(cc1)O)C.ClCC(COCC1OC1)O Request for Quotation
Chemical Name: 2-Propanol,1-chloro-3-[4-[1-methyl-1-[4-(oxiranylmethoxy)phenyl]ethyl]phenoxy]-
CAS Number: 13836-48-1
Product Number: AG009DBG(AGN-PC-0PMLGY)
Synonyms:
MDL No:
Molecular Formula: C21H27ClO5
Molecular Weight: 394.88908

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


Bisphenol A (3-Chloro-2-hydroxypropyl) Glycidyl Ether is a versatile compound that finds wide applications in chemical synthesis. This reactive chemical is commonly used as a building block in the production of various epoxy resins. The presence of a chloro and hydroxyl group in its structure makes it a valuable intermediate for synthesizing complex organic compounds.In chemical synthesis, Bisphenol A (3-Chloro-2-hydroxypropyl) Glycidyl Ether acts as a key component in the modification and functionalization of polymers. Its reactivity allows for the formation of cross-linked networks, which is essential in creating durable coatings, adhesives, and composites. Additionally, this compound serves as a crucial epoxy equivalent in preparing specialty resins with tailored properties such as improved adhesion, thermal stability, and chemical resistance.Furthermore, Bisphenol A (3-Chloro-2-hydroxypropyl) Glycidyl Ether can be utilized in the development of advanced materials for various industries including aerospace, automotive, and electronics. Its ability to undergo controlled polymerization reactions enables the design of high-performance polymers that exhibit enhanced mechanical strength and dimensional stability.Overall, Bisphenol A (3-Chloro-2-hydroxypropyl) Glycidyl Ether plays a significant role in chemical synthesis by providing a platform for creating innovative materials with diverse applications in modern technology and manufacturing processes.