1. Home
  2. 2-Bromo-6-methoxy-4-(trifluoromethyl)pyridine

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

2-Bromo-6-methoxy-4-(trifluoromethyl)pyridine

Request for Quotation
Chemical Name: 2-Bromo-6-methoxy-4-(trifluoromethyl)pyridine
CAS Number: 1211536-10-5
Product Number: AG01EDBV(AGN-PC-0WD4EK)
Synonyms:
MDL No:
Molecular Formula:
Molecular Weight:

Identification/Properties

Safety Information

GHS Pictogram:
N/A
Signal Word:
UN#:
-
Hazard Statements:
-
Precautionary Statements:
Class:
-
Packing Group:
-

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


2-Bromo-6-methoxy-4-(trifluoromethyl)pyridine is a versatile compound widely used in chemical synthesis due to its unique properties. It serves as a valuable building block in the preparation of various pharmaceuticals, agrochemicals, and specialty chemicals. With its trifluoromethyl and methoxy functional groups, this compound plays a crucial role in introducing specific structural motifs into organic molecules, enhancing their biological activity and chemical reactivity.In organic synthesis, 2-Bromo-6-methoxy-4-(trifluoromethyl)pyridine can be used as a key intermediate for the synthesis of complex molecules such as pyridine-based ligands, heterocycles, and fluorinated compounds. Its bromine atom and trifluoromethyl group enable diverse synthetic transformations, including cross-coupling reactions, nucleophilic substitutions, and metal-catalyzed coupling reactions. By strategically incorporating this compound into chemical reactions, chemists can access a wide range of novel compounds with tailored properties and functionalities.Moreover, the presence of a methoxy group in 2-Bromo-6-methoxy-4-(trifluoromethyl)pyridine further expands its synthetic utility by facilitating regioselective reactions and providing a handle for further derivatization. This compound's compatibility with various reaction conditions and its ability to participate in diverse synthetic methodologies make it a valuable tool for designing and preparing complex molecular architectures with precision and efficiency.Overall, 2-Bromo-6-methoxy-4-(trifluoromethyl)pyridine is an indispensable building block in modern synthetic chemistry, offering chemists a powerful means to access structurally diverse and biologically relevant molecules through innovative synthetic routes and strategic functional group manipulations.