1. Home
  2. Tert-Butyl 5-Bromo-2,3-Dihydrospiro[Indene-1,4-Piperidine]-1-Carboxylate

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

Tert-Butyl 5-Bromo-2,3-Dihydrospiro[Indene-1,4-Piperidine]-1-Carboxylate

Brc1ccc2c(c1)CCC12CCN(CC1)C(=O)OC(C)(C)C Request for Quotation
Chemical Name: Tert-Butyl 5-Bromo-2,3-Dihydrospiro[Indene-1,4-Piperidine]-1-Carboxylate
CAS Number: 1160247-40-4
Product Number: AG00HD7W(AGN-PC-0WG4I4)
Synonyms:
MDL No:
Molecular Formula: C18H24BrNO2
Molecular Weight: 366.2927

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


The tert-Butyl 5-Bromo-2,3-dihydrospiro[indene-1,4'-piperidine]-1'-carboxylate is a versatile compound widely utilized in chemical synthesis. With its unique structure and reactivity, this compound serves as a valuable building block in the creation of various complex molecules. In chemical synthesis, tert-Butyl 5-Bromo-2,3-dihydrospiro[indene-1,4'-piperidine]-1'-carboxylate can be employed as a key intermediate in the formation of heterocyclic compounds and pharmaceutical agents. Its spirocyclic structure offers opportunities for the construction of diverse molecular frameworks, making it a valuable tool for organic chemists seeking to design and develop new compounds with desired properties.Additionally, the presence of the bromo group in this compound allows for further functionalization through various reactions such as substitution or coupling reactions. This enables chemists to modify the structure of the molecule to introduce specific functionalities or tailor its properties for targeted applications.Overall, the tert-Butyl 5-Bromo-2,3-dihydrospiro[indene-1,4'-piperidine]-1'-carboxylate plays a crucial role in chemical synthesis by providing a strategic starting point for the creation of intricate and biologically active compounds.